C26H24N2O3S — CID 68648682
N-benzyl-3-methyl-5-[2-oxo-4-(2-phenylethoxy)-1H-pyridin-3-yl]thiophene-2-carboxamide (PubChem CID 68648682) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-benzyl-3-methyl-5-[2-oxo-4-(2-phenylethoxy)-1H-pyridin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-benzyl-3-methyl-5-[2-oxo-4-(2-phenylethoxy)-1H-pyridin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 68648682 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-benzyl-3-methyl-5-[2-oxo-4-(2-phenylethoxy)-1H-pyridin-3-yl]thiophene-2-carboxamide |
| SMILES | Cc1cc(-c2c(OCCc3ccccc3)cc[nH]c2=O)sc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H24N2O3S/c1-18-16-22(32-24(18)26(30)28-17-20-10-6-3-7-11-20)23-21(12-14-27-25(23)29)31-15-13-19-8-4-2-5-9-19/h2-12,14,16H,13,15,17H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | VAVOPQJWAMXEGV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |