C26H19FN4O5 — CID 6864888
2-[(2-fluorobenzoyl)amino]-N-[(E)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 6864888) has the molecular formula C26H19FN4O5 and a molecular weight of 486.46 g/mol. Its IUPAC name is 2-[(2-fluorobenzoyl)amino]-N-[(E)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 2-[(2-fluorobenzoyl)amino]-N-[(E)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6864888 |
| Molecular Formula | C26H19FN4O5 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2-[(2-fluorobenzoyl)amino]-N-[(E)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | Cc1c(-c2ccc(/C=N/NC(=O)c3ccccc3NC(=O)c3ccccc3F)o2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H19FN4O5/c1-16-18(9-6-12-23(16)31(34)35)24-14-13-17(36-24)15-28-30-26(33)20-8-3-5-11-22(20)29-25(32)19-7-2-4-10-21(19)27/h2-15H,1H3,(H,29,32)(H,30,33)/b28-15+ |
| InChIKey | TTZOBWUJXFYOBQ-RWPZCVJISA-N |
| XLogP | 5.32 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|