C16H30F2 — CID 68649915
1,1-difluoro-2,2,3,3,4,4,5,5,6,6-decamethylcyclohexane (PubChem CID 68649915) has the molecular formula C16H30F2 and a molecular weight of 260.41 g/mol. Its IUPAC name is 1,1-difluoro-2,2,3,3,4,4,5,5,6,6-decamethylcyclohexane.
| Compound Name | 1,1-difluoro-2,2,3,3,4,4,5,5,6,6-decamethylcyclohexane |
|---|---|
| PubChem CID | 68649915 |
| Molecular Formula | C16H30F2 |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1,1-difluoro-2,2,3,3,4,4,5,5,6,6-decamethylcyclohexane |
| SMILES | CC1(C)C(C)(C)C(C)(C)C(F)(F)C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H30F2/c1-11(2)12(3,4)14(7,8)16(17,18)15(9,10)13(11,5)6/h1-10H3 |
| InChIKey | ROSXIHYTGAXREZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |