C14H11F2NO — CID 68650306
N-[(2,6-difluorophenyl)methyl]benzamide (PubChem CID 68650306) has the molecular formula C14H11F2NO and a molecular weight of 247.24 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]benzamide.
| Compound Name | N-[(2,6-difluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 68650306 |
| Molecular Formula | C14H11F2NO |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1c(F)cccc1F)c1ccccc1 |
| InChI | InChI=1S/C14H11F2NO/c15-12-7-4-8-13(16)11(12)9-17-14(18)10-5-2-1-3-6-10/h1-8H,9H2,(H,17,18) |
| InChIKey | WNJROYWWZXQAIR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |