C16H17NO5 — CID 68650745
methyl (4R,9aS)-1,6-dioxo-4-phenyl-3,4,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazine-9-carboxylate (PubChem CID 68650745) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is methyl (4R,9aS)-1,6-dioxo-4-phenyl-3,4,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazine-9-carboxylate.
| Compound Name | methyl (4R,9aS)-1,6-dioxo-4-phenyl-3,4,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazine-9-carboxylate |
|---|---|
| PubChem CID | 68650745 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | methyl (4R,9aS)-1,6-dioxo-4-phenyl-3,4,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazine-9-carboxylate |
| SMILES | COC(=O)C1CCC(=O)N2[C@@H]1C(=O)OC[C@H]2c1ccccc1 |
| InChI | InChI=1S/C16H17NO5/c1-21-15(19)11-7-8-13(18)17-12(9-22-16(20)14(11)17)10-5-3-2-4-6-10/h2-6,11-12,14H,7-9H2,1H3/t11?,12-,14-/m0/s1 |
| InChIKey | VUVSFCHPBGFDES-WGIUUAEBSA-N |
| XLogP | 1.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |