C25H29N5O2 — CID 68651636
3-amino-6-[3-[[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]-N-(4-hydroxybutyl)pyrazine-2-carboxamide (PubChem CID 68651636) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 3-amino-6-[3-[[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]-N-(4-hydroxybutyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-[3-[[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]-N-(4-hydroxybutyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 68651636 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 3-amino-6-[3-[[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]-N-(4-hydroxybutyl)pyrazine-2-carboxamide |
| SMILES | Nc1ncc(-c2cccc(CN[C@H]3CCc4ccccc43)c2)nc1C(=O)NCCCCO |
| InChI | InChI=1S/C25H29N5O2/c26-24-23(25(32)27-12-3-4-13-31)30-22(16-29-24)19-8-5-6-17(14-19)15-28-21-11-10-18-7-1-2-9-20(18)21/h1-2,5-9,14,16,21,28,31H,3-4,10-13,15H2,(H2,26,29)(H,27,32)/t21-/m0/s1 |
| InChIKey | VZUJVTKAHUYXGM-NRFANRHFSA-N |
| XLogP | 3.01 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|