C12H18N4O2S — CID 68652076
4-(4,4-diaminocyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diamine (PubChem CID 68652076) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-(4,4-diaminocyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 4-(4,4-diaminocyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 68652076 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-(4,4-diaminocyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diamine |
| SMILES | NC1(N)C=CC(S(=O)(=O)C2=CCC(N)(N)C=C2)=CC1 |
| InChI | InChI=1S/C12H18N4O2S/c13-11(14)5-1-9(2-6-11)19(17,18)10-3-7-12(15,16)8-4-10/h1-5,7H,6,8,13-16H2 |
| InChIKey | YQIMPOZJASMUNN-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|