C16H22N2O — CID 68652246
5-[(1R,5R,6E)-1-amino-6-ethylidene-3,5-dimethylcyclohex-3-en-1-yl]-6-methyl-1H-pyridin-2-one (PubChem CID 68652246) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 5-[(1R,5R,6E)-1-amino-6-ethylidene-3,5-dimethylcyclohex-3-en-1-yl]-6-methyl-1H-pyridin-2-one.
| Compound Name | 5-[(1R,5R,6E)-1-amino-6-ethylidene-3,5-dimethylcyclohex-3-en-1-yl]-6-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 68652246 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 5-[(1R,5R,6E)-1-amino-6-ethylidene-3,5-dimethylcyclohex-3-en-1-yl]-6-methyl-1H-pyridin-2-one |
| SMILES | C/C=C1\[C@H](C)C=C(C)C[C@]1(N)c1ccc(=O)[nH]c1C |
| InChI | InChI=1S/C16H22N2O/c1-5-13-11(3)8-10(2)9-16(13,17)14-6-7-15(19)18-12(14)4/h5-8,11H,9,17H2,1-4H3,(H,18,19)/b13-5+/t11-,16-/m1/s1 |
| InChIKey | FKPZGLPPFDRQMV-SXYXCRMUSA-N |
| XLogP | 2.77 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|