About 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole
5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole (PubChem CID 68652430) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole.
Molecular Properties
| Compound Name | 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole |
| PubChem CID | 68652430 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole |
| SMILES | c1cc(C2CC3(CCCN3)C2)sn1 |
| InChI | InChI=1S/C10H14N2S/c1-3-10(11-4-1)6-8(7-10)9-2-5-12-13-9/h2,5,8,11H,1,3-4,6-7H2 |
| InChIKey | QMBFAYPMSACUNO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole?
The IUPAC name of 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole (CID 68652430) is 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole.
What is the SMILES notation for 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole?
The canonical SMILES for 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole is c1cc(C2CC3(CCCN3)C2)sn1.
What is the InChIKey of 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole?
The InChIKey is QMBFAYPMSACUNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S/c1-3-10(11-4-1)6-8(7-10)9-2-5-12-13-9/h2,5,8,11H,1,3-4,6-7H2.
What are the key properties of 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole?
5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole has a molecular weight of 194.30 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-azaspiro[3.4]octan-2-yl)-1,2-thiazole is sourced from PubChem (CID 68652430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).