C31H30IN5O7S — CID 68653053
2-[5-[8-[[2-(2-iodophenyl)-1,3-dioxol-4-yl]sulfanyl]-1-(2-methoxyethoxymethyl)-6-oxopurin-9-yl]pentyl]isoindole-1,3-dione (PubChem CID 68653053) has the molecular formula C31H30IN5O7S and a molecular weight of 743.58 g/mol. Its IUPAC name is 2-[5-[8-[[2-(2-iodophenyl)-1,3-dioxol-4-yl]sulfanyl]-1-(2-methoxyethoxymethyl)-6-oxopurin-9-yl]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[8-[[2-(2-iodophenyl)-1,3-dioxol-4-yl]sulfanyl]-1-(2-methoxyethoxymethyl)-6-oxopurin-9-yl]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 68653053 |
| Molecular Formula | C31H30IN5O7S |
| Molecular Weight | 743.58 g/mol |
| Exact Mass | 743.09 |
| IUPAC Name | 2-[5-[8-[[2-(2-iodophenyl)-1,3-dioxol-4-yl]sulfanyl]-1-(2-methoxyethoxymethyl)-6-oxopurin-9-yl]pentyl]isoindole-1,3-dione |
| SMILES | COCCOCn1cnc2c(nc(SC3=COC(c4ccccc4I)O3)n2CCCCCN2C(=O)c3ccccc3C2=O)c1=O |
| InChI | InChI=1S/C31H30IN5O7S/c1-41-15-16-42-19-35-18-33-26-25(29(35)40)34-31(45-24-17-43-30(44-24)22-11-5-6-12-23(22)32)36(26)13-7-2-8-14-37-27(38)20-9-3-4-10-21(20)28(37)39/h3-6,9-12,17-18,30H,2,7-8,13-16,19H2,1H3 |
| InChIKey | RJZJKHVDLCUCGK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 127.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|