About 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine
7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine (PubChem CID 68653528) has the molecular formula C18H13ClF3N5
and a molecular weight of 391.78 g/mol. Its IUPAC name is 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine.
Molecular Properties
| Compound Name | 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine |
| PubChem CID | 68653528 |
| Molecular Formula | C18H13ClF3N5 |
| Molecular Weight | 391.78 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine |
| SMILES | Cc1cc(Cl)c2c(n1)c(-c1ccc(-n3cccn3)cc1C(F)(F)F)nn2C |
| InChI | InChI=1S/C18H13ClF3N5/c1-10-8-14(19)17-16(24-10)15(25-26(17)2)12-5-4-11(27-7-3-6-23-27)9-13(12)18(20,21)22/h3-9H,1-2H3 |
| InChIKey | DJABTWXPDTUYGN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.78 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine?
The IUPAC name of 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine (CID 68653528) is 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine.
What is the SMILES notation for 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine?
The canonical SMILES for 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine is Cc1cc(Cl)c2c(n1)c(-c1ccc(-n3cccn3)cc1C(F)(F)F)nn2C.
What is the InChIKey of 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine?
The InChIKey is DJABTWXPDTUYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClF3N5/c1-10-8-14(19)17-16(24-10)15(25-26(17)2)12-5-4-11(27-7-3-6-23-27)9-13(12)18(20,21)22/h3-9H,1-2H3.
What are the key properties of 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine?
7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine has a molecular weight of 391.78 g/mol, XLogP of 4.80, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1,5-dimethyl-3-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]pyrazolo[4,3-b]pyridine is sourced from PubChem (CID 68653528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).