About [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate
[3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate (PubChem CID 68653852) has the molecular formula C14H18Cl2N2O2
and a molecular weight of 317.22 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate.
Molecular Properties
| Compound Name | [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate |
| PubChem CID | 68653852 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCC1(c2ccc(Cl)c(Cl)c2)CCCNC1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-17-13(19)20-9-14(5-2-6-18-8-14)10-3-4-11(15)12(16)7-10/h3-4,7,18H,2,5-6,8-9H2,1H3,(H,17,19) |
| InChIKey | WBIYKWINQVNWLD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate?
The IUPAC name of [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate (CID 68653852) is [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate.
What is the SMILES notation for [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate?
The canonical SMILES for [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate is CNC(=O)OCC1(c2ccc(Cl)c(Cl)c2)CCCNC1.
What is the InChIKey of [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate?
The InChIKey is WBIYKWINQVNWLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl2N2O2/c1-17-13(19)20-9-14(5-2-6-18-8-14)10-3-4-11(15)12(16)7-10/h3-4,7,18H,2,5-6,8-9H2,1H3,(H,17,19).
What are the key properties of [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate?
[3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate has a molecular weight of 317.22 g/mol, XLogP of 2.97, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,4-dichlorophenyl)piperidin-3-yl]methyl N-methylcarbamate is sourced from PubChem (CID 68653852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).