About 5-(furan-2-yl)-N,2-dimethylaniline
5-(furan-2-yl)-N,2-dimethylaniline (PubChem CID 68654005) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 5-(furan-2-yl)-N,2-dimethylaniline.
Molecular Properties
| Compound Name | 5-(furan-2-yl)-N,2-dimethylaniline |
| PubChem CID | 68654005 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 5-(furan-2-yl)-N,2-dimethylaniline |
| SMILES | CNc1cc(-c2ccco2)ccc1C |
| InChI | InChI=1S/C12H13NO/c1-9-5-6-10(8-11(9)13-2)12-4-3-7-14-12/h3-8,13H,1-2H3 |
| InChIKey | OJPFUEXMNDDBLU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(furan-2-yl)-N,2-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-2-yl)-N,2-dimethylaniline?
The IUPAC name of 5-(furan-2-yl)-N,2-dimethylaniline (CID 68654005) is 5-(furan-2-yl)-N,2-dimethylaniline.
What is the SMILES notation for 5-(furan-2-yl)-N,2-dimethylaniline?
The canonical SMILES for 5-(furan-2-yl)-N,2-dimethylaniline is CNc1cc(-c2ccco2)ccc1C.
What is the InChIKey of 5-(furan-2-yl)-N,2-dimethylaniline?
The InChIKey is OJPFUEXMNDDBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-9-5-6-10(8-11(9)13-2)12-4-3-7-14-12/h3-8,13H,1-2H3.
What are the key properties of 5-(furan-2-yl)-N,2-dimethylaniline?
5-(furan-2-yl)-N,2-dimethylaniline has a molecular weight of 187.24 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-yl)-N,2-dimethylaniline is sourced from PubChem (CID 68654005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).