About 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one
1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 68654087) has the molecular formula C20H20N2O6S
and a molecular weight of 416.46 g/mol. Its IUPAC name is 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one |
| PubChem CID | 68654087 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | O=C1N(c2ccccc2S(=O)(=O)N2CCOCC2)c2ccccc2C12OCCO2 |
| InChI | InChI=1S/C20H20N2O6S/c23-19-20(27-13-14-28-20)15-5-1-2-6-16(15)22(19)17-7-3-4-8-18(17)29(24,25)21-9-11-26-12-10-21/h1-8H,9-14H2 |
| InChIKey | UBCBIMIZCZUTQA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one?
The IUPAC name of 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one (CID 68654087) is 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one.
What is the SMILES notation for 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one?
The canonical SMILES for 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one is O=C1N(c2ccccc2S(=O)(=O)N2CCOCC2)c2ccccc2C12OCCO2.
What is the InChIKey of 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one?
The InChIKey is UBCBIMIZCZUTQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O6S/c23-19-20(27-13-14-28-20)15-5-1-2-6-16(15)22(19)17-7-3-4-8-18(17)29(24,25)21-9-11-26-12-10-21/h1-8H,9-14H2.
What are the key properties of 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one?
1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one has a molecular weight of 416.46 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(2-morpholin-4-ylsulfonylphenyl)spiro[1,3-dioxolane-2,3'-indole]-2'-one is sourced from PubChem (CID 68654087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).