C32H30F3N3O2S — CID 68655044
N,N-diethyl-1-phenyl-4-(3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl)quinolin-1-ium-2-amine;2,2,2-trifluoroacetate (PubChem CID 68655044) has the molecular formula C32H30F3N3O2S and a molecular weight of 577.67 g/mol. Its IUPAC name is N,N-diethyl-1-phenyl-4-(3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl)quinolin-1-ium-2-amine;2,2,2-trifluoroacetate.
| Compound Name | N,N-diethyl-1-phenyl-4-(3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl)quinolin-1-ium-2-amine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68655044 |
| Molecular Formula | C32H30F3N3O2S |
| Molecular Weight | 577.67 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | N,N-diethyl-1-phenyl-4-(3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl)quinolin-1-ium-2-amine;2,2,2-trifluoroacetate |
| SMILES | CCN(CC)c1cc(C=C2Sc3cccc4c3N2CCC4)c2ccccc2[n+]1-c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C30H30N3S.C2HF3O2/c1-3-31(4-2)28-20-23(21-29-32-19-11-13-22-12-10-18-27(34-29)30(22)32)25-16-8-9-17-26(25)33(28)24-14-6-5-7-15-24;3-2(4,5)1(6)7/h5-10,12,14-18,20-21H,3-4,11,13,19H2,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | RFHPZPHROHTJCB-UHFFFAOYSA-M |
| XLogP | 6.12 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|