C24H29BrN4O4 — CID 68655142
5-(5-bromo-2,4-dibutoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 68655142) has the molecular formula C24H29BrN4O4 and a molecular weight of 517.42 g/mol. Its IUPAC name is 5-(5-bromo-2,4-dibutoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-(5-bromo-2,4-dibutoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 68655142 |
| Molecular Formula | C24H29BrN4O4 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 5-(5-bromo-2,4-dibutoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CCCCOc1cc(OCCCC)c(-c2nnc(C(N)=O)n2-c2ccc(OC)cc2)cc1Br |
| InChI | InChI=1S/C24H29BrN4O4/c1-4-6-12-32-20-15-21(33-13-7-5-2)19(25)14-18(20)23-27-28-24(22(26)30)29(23)16-8-10-17(31-3)11-9-16/h8-11,14-15H,4-7,12-13H2,1-3H3,(H2,26,30) |
| InChIKey | VOJVINVSSAPJLB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|