C8H5BrN2O6 — CID 68655260
2-(3-bromo-5-nitro-4-pyridinyl)propanedioic acid (PubChem CID 68655260) has the molecular formula C8H5BrN2O6 and a molecular weight of 305.04 g/mol. Its IUPAC name is 2-(3-bromo-5-nitro-4-pyridinyl)propanedioic acid.
| Compound Name | 2-(3-bromo-5-nitro-4-pyridinyl)propanedioic acid |
|---|---|
| PubChem CID | 68655260 |
| Molecular Formula | C8H5BrN2O6 |
| Molecular Weight | 305.04 g/mol |
| Exact Mass | 303.93 |
| IUPAC Name | 2-(3-bromo-5-nitro-4-pyridinyl)propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)c1c(Br)cncc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5BrN2O6/c9-3-1-10-2-4(11(16)17)5(3)6(7(12)13)8(14)15/h1-2,6H,(H,12,13)(H,14,15) |
| InChIKey | KVXLXAIWXVYLRE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.04 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|