C13H9F2NO4S — CID 68655394
2-[[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]methyl]propanedioic acid (PubChem CID 68655394) has the molecular formula C13H9F2NO4S and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-[[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]methyl]propanedioic acid.
| Compound Name | 2-[[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 68655394 |
| Molecular Formula | C13H9F2NO4S |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 2-[[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]methyl]propanedioic acid |
| SMILES | O=C(O)C(Cc1csc(-c2ccc(F)cc2F)n1)C(=O)O |
| InChI | InChI=1S/C13H9F2NO4S/c14-6-1-2-8(10(15)3-6)11-16-7(5-21-11)4-9(12(17)18)13(19)20/h1-3,5,9H,4H2,(H,17,18)(H,19,20) |
| InChIKey | VCZBKOSZRMVQNJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|