C25H22FNO4S2 — CID 68655496
ethyl 1-(2-fluorophenyl)-2-methyl-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrrole-3-carboxylate (PubChem CID 68655496) has the molecular formula C25H22FNO4S2 and a molecular weight of 483.59 g/mol. Its IUPAC name is ethyl 1-(2-fluorophenyl)-2-methyl-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrrole-3-carboxylate.
| Compound Name | ethyl 1-(2-fluorophenyl)-2-methyl-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 68655496 |
| Molecular Formula | C25H22FNO4S2 |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | ethyl 1-(2-fluorophenyl)-2-methyl-5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(-c3cccc(S(C)(=O)=O)c3)s2)n(-c2ccccc2F)c1C |
| InChI | InChI=1S/C25H22FNO4S2/c1-4-31-25(28)19-15-22(27(16(19)2)21-11-6-5-10-20(21)26)24-13-12-23(32-24)17-8-7-9-18(14-17)33(3,29)30/h5-15H,4H2,1-3H3 |
| InChIKey | CBWSHBYQJYSLGH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|