C24H56O8Si4 — CID 68655932
2,4,6,8-tetrakis(1-methoxyethyl)-2,4,6,8-tetrapropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 68655932) has the molecular formula C24H56O8Si4 and a molecular weight of 585.05 g/mol. Its IUPAC name is 2,4,6,8-tetrakis(1-methoxyethyl)-2,4,6,8-tetrapropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetrakis(1-methoxyethyl)-2,4,6,8-tetrapropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 68655932 |
| Molecular Formula | C24H56O8Si4 |
| Molecular Weight | 585.05 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 2,4,6,8-tetrakis(1-methoxyethyl)-2,4,6,8-tetrapropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCC[Si]1(C(C)OC)O[Si](CCC)(C(C)OC)O[Si](CCC)(C(C)OC)O[Si](CCC)(C(C)OC)O1 |
| InChI | InChI=1S/C24H56O8Si4/c1-13-17-33(21(5)25-9)29-34(18-14-2,22(6)26-10)31-36(20-16-4,24(8)28-12)32-35(30-33,19-15-3)23(7)27-11/h21-24H,13-20H2,1-12H3 |
| InChIKey | VWJWZORKBHSZIG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.05 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|