C24H54O6Si3 — CID 68656099
2,4,6-tritert-butyl-2,4,6-tris(propan-2-yloxymethyl)-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 68656099) has the molecular formula C24H54O6Si3 and a molecular weight of 522.95 g/mol. Its IUPAC name is 2,4,6-tritert-butyl-2,4,6-tris(propan-2-yloxymethyl)-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,4,6-tritert-butyl-2,4,6-tris(propan-2-yloxymethyl)-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 68656099 |
| Molecular Formula | C24H54O6Si3 |
| Molecular Weight | 522.95 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | 2,4,6-tritert-butyl-2,4,6-tris(propan-2-yloxymethyl)-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | CC(C)OC[Si]1(C(C)(C)C)O[Si](COC(C)C)(C(C)(C)C)O[Si](COC(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C24H54O6Si3/c1-19(2)25-16-31(22(7,8)9)28-32(23(10,11)12,17-26-20(3)4)30-33(29-31,24(13,14)15)18-27-21(5)6/h19-21H,16-18H2,1-15H3 |
| InChIKey | SVNZRESFNKUGDC-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.95 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|