About 5-amino-6-iminocyclohexa-2,4-dien-1-one
5-amino-6-iminocyclohexa-2,4-dien-1-one (PubChem CID 68656243) has the molecular formula C6H6N2O
and a molecular weight of 122.13 g/mol. Its IUPAC name is 5-amino-6-iminocyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 5-amino-6-iminocyclohexa-2,4-dien-1-one |
| PubChem CID | 68656243 |
| Molecular Formula | C6H6N2O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 5-amino-6-iminocyclohexa-2,4-dien-1-one |
| SMILES | [H]/N=C1\C(=O)C=CC=C1N |
| InChI | InChI=1S/C6H6N2O/c7-4-2-1-3-5(9)6(4)8/h1-3,8H,7H2/b8-6- |
| InChIKey | JRVAHUSKCNAJEY-VURMDHGXSA-N |
| XLogP | -0.01 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-6-iminocyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-iminocyclohexa-2,4-dien-1-one?
The IUPAC name of 5-amino-6-iminocyclohexa-2,4-dien-1-one (CID 68656243) is 5-amino-6-iminocyclohexa-2,4-dien-1-one.
What is the SMILES notation for 5-amino-6-iminocyclohexa-2,4-dien-1-one?
The canonical SMILES for 5-amino-6-iminocyclohexa-2,4-dien-1-one is [H]/N=C1\C(=O)C=CC=C1N.
What is the InChIKey of 5-amino-6-iminocyclohexa-2,4-dien-1-one?
The InChIKey is JRVAHUSKCNAJEY-VURMDHGXSA-N. The full InChI is InChI=1S/C6H6N2O/c7-4-2-1-3-5(9)6(4)8/h1-3,8H,7H2/b8-6-.
What are the key properties of 5-amino-6-iminocyclohexa-2,4-dien-1-one?
5-amino-6-iminocyclohexa-2,4-dien-1-one has a molecular weight of 122.13 g/mol, XLogP of -0.01, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-iminocyclohexa-2,4-dien-1-one is sourced from PubChem (CID 68656243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).