C33H51N3O3Si3 — CID 68656752
4-[4,6-bis[4-(diethylamino)phenyl]-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]-N,N-diethylaniline (PubChem CID 68656752) has the molecular formula C33H51N3O3Si3 and a molecular weight of 622.05 g/mol. Its IUPAC name is 4-[4,6-bis[4-(diethylamino)phenyl]-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]-N,N-diethylaniline.
| Compound Name | 4-[4,6-bis[4-(diethylamino)phenyl]-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 68656752 |
| Molecular Formula | C33H51N3O3Si3 |
| Molecular Weight | 622.05 g/mol |
| Exact Mass | 621.32 |
| IUPAC Name | 4-[4,6-bis[4-(diethylamino)phenyl]-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc([Si]2(C)O[Si](C)(c3ccc(N(CC)CC)cc3)O[Si](C)(c3ccc(N(CC)CC)cc3)O2)cc1 |
| InChI | InChI=1S/C33H51N3O3Si3/c1-10-34(11-2)28-16-22-31(23-17-28)40(7)37-41(8,32-24-18-29(19-25-32)35(12-3)13-4)39-42(9,38-40)33-26-20-30(21-27-33)36(14-5)15-6/h16-27H,10-15H2,1-9H3 |
| InChIKey | BYJVKFCVCCNWOK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.05 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|