C20H48O8Si4 — CID 68656763
2,4,6,8-tetraethyl-2,4,6,8-tetra(propan-2-yloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 68656763) has the molecular formula C20H48O8Si4 and a molecular weight of 528.94 g/mol. Its IUPAC name is 2,4,6,8-tetraethyl-2,4,6,8-tetra(propan-2-yloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetraethyl-2,4,6,8-tetra(propan-2-yloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 68656763 |
| Molecular Formula | C20H48O8Si4 |
| Molecular Weight | 528.94 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 2,4,6,8-tetraethyl-2,4,6,8-tetra(propan-2-yloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CC[Si]1(OC(C)C)O[Si](CC)(OC(C)C)O[Si](CC)(OC(C)C)O[Si](CC)(OC(C)C)O1 |
| InChI | InChI=1S/C20H48O8Si4/c1-13-29(21-17(5)6)25-30(14-2,22-18(7)8)27-32(16-4,24-20(11)12)28-31(15-3,26-29)23-19(9)10/h17-20H,13-16H2,1-12H3 |
| InChIKey | BUTUOHLHHGTLAD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.94 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|