C19H11ClF3N5OS2 — CID 68656832
4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide (PubChem CID 68656832) has the molecular formula C19H11ClF3N5OS2 and a molecular weight of 481.91 g/mol. Its IUPAC name is 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide.
| Compound Name | 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 68656832 |
| Molecular Formula | C19H11ClF3N5OS2 |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide |
| SMILES | O=C(Nc1n[nH]c(=S)s1)c1ccc(-c2cc(C(F)(F)F)nn2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H11ClF3N5OS2/c20-12-3-1-2-4-13(12)28-14(9-15(27-28)19(21,22)23)10-5-7-11(8-6-10)16(29)24-17-25-26-18(30)31-17/h1-9H,(H,26,30)(H,24,25,29) |
| InChIKey | RZWSGXGHDZGVIR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|