About N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine
N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine (PubChem CID 68657090) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine.
Molecular Properties
| Compound Name | N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine |
| PubChem CID | 68657090 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine |
| SMILES | CCNCCc1cc(C)on1 |
| InChI | InChI=1S/C8H14N2O/c1-3-9-5-4-8-6-7(2)11-10-8/h6,9H,3-5H2,1-2H3 |
| InChIKey | GCROJHVFCGZHDU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine?
The IUPAC name of N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine (CID 68657090) is N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine.
What is the SMILES notation for N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine?
The canonical SMILES for N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine is CCNCCc1cc(C)on1.
What is the InChIKey of N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine?
The InChIKey is GCROJHVFCGZHDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-3-9-5-4-8-6-7(2)11-10-8/h6,9H,3-5H2,1-2H3.
What are the key properties of N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine?
N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine has a molecular weight of 154.21 g/mol, XLogP of 1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(5-methyl-1,2-oxazol-3-yl)ethanamine is sourced from PubChem (CID 68657090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).