C25H60O10Si5 — CID 68657141
2,4,6,8,10-pentamethoxy-2,4,6,8,10-pentakis(2-methylpropyl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 68657141) has the molecular formula C25H60O10Si5 and a molecular weight of 661.18 g/mol. Its IUPAC name is 2,4,6,8,10-pentamethoxy-2,4,6,8,10-pentakis(2-methylpropyl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,4,6,8,10-pentamethoxy-2,4,6,8,10-pentakis(2-methylpropyl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 68657141 |
| Molecular Formula | C25H60O10Si5 |
| Molecular Weight | 661.18 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | 2,4,6,8,10-pentamethoxy-2,4,6,8,10-pentakis(2-methylpropyl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CO[Si]1(CC(C)C)O[Si](CC(C)C)(OC)O[Si](CC(C)C)(OC)O[Si](CC(C)C)(OC)O[Si](CC(C)C)(OC)O1 |
| InChI | InChI=1S/C25H60O10Si5/c1-21(2)16-36(26-11)31-37(27-12,17-22(3)4)33-39(29-14,19-24(7)8)35-40(30-15,20-25(9)10)34-38(28-13,32-36)18-23(5)6/h21-25H,16-20H2,1-15H3 |
| InChIKey | MNNZBVOMQUNXON-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.18 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|