About 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine
2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine (PubChem CID 68657310) has the molecular formula C11H9F2N
and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine.
Molecular Properties
| Compound Name | 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine |
| PubChem CID | 68657310 |
| Molecular Formula | C11H9F2N |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine |
| SMILES | FC1=CCC(F)(c2ccccn2)C=C1 |
| InChI | InChI=1S/C11H9F2N/c12-9-4-6-11(13,7-5-9)10-3-1-2-8-14-10/h1-6,8H,7H2 |
| InChIKey | TVQJKXNWKNWXSC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine?
The IUPAC name of 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine (CID 68657310) is 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine.
What is the SMILES notation for 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine?
The canonical SMILES for 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine is FC1=CCC(F)(c2ccccn2)C=C1.
What is the InChIKey of 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine?
The InChIKey is TVQJKXNWKNWXSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2N/c12-9-4-6-11(13,7-5-9)10-3-1-2-8-14-10/h1-6,8H,7H2.
What are the key properties of 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine?
2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine has a molecular weight of 193.20 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-difluorocyclohexa-2,4-dien-1-yl)pyridine is sourced from PubChem (CID 68657310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).