C44H42F2N14 — CID 68657525
1,2-bis[7-(2-fluoro-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-1,2-bis[4-(4-methylpiperazin-1-yl)phenyl]hydrazine (PubChem CID 68657525) has the molecular formula C44H42F2N14 and a molecular weight of 804.91 g/mol. Its IUPAC name is 1,2-bis[7-(2-fluoro-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-1,2-bis[4-(4-methylpiperazin-1-yl)phenyl]hydrazine.
| Compound Name | 1,2-bis[7-(2-fluoro-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-1,2-bis[4-(4-methylpiperazin-1-yl)phenyl]hydrazine |
|---|---|
| PubChem CID | 68657525 |
| Molecular Formula | C44H42F2N14 |
| Molecular Weight | 804.91 g/mol |
| Exact Mass | 804.37 |
| IUPAC Name | 1,2-bis[7-(2-fluoro-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-1,2-bis[4-(4-methylpiperazin-1-yl)phenyl]hydrazine |
| SMILES | CN1CCN(c2ccc(N(c3ncc4ccc(-c5cccnc5F)n4n3)N(c3ccc(N4CCN(C)CC4)cc3)c3ncc4ccc(-c5cccnc5F)n4n3)cc2)CC1 |
| InChI | InChI=1S/C44H42F2N14/c1-53-21-25-55(26-22-53)31-7-11-33(12-8-31)59(43-49-29-35-15-17-39(57(35)51-43)37-5-3-19-47-41(37)45)60(34-13-9-32(10-14-34)56-27-23-54(2)24-28-56)44-50-30-36-16-18-40(58(36)52-44)38-6-4-20-48-42(38)46/h3-20,29-30H,21-28H2,1-2H3 |
| InChIKey | ZYOMSWXXGBCVEN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 105.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.91 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|