C25H25ClFN3O2 — CID 68657538
1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-(4-fluoro-2-methoxyphenyl)pyridin-2-one;hydrochloride (PubChem CID 68657538) has the molecular formula C25H25ClFN3O2 and a molecular weight of 453.95 g/mol. Its IUPAC name is 1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-(4-fluoro-2-methoxyphenyl)pyridin-2-one;hydrochloride.
| Compound Name | 1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-(4-fluoro-2-methoxyphenyl)pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 68657538 |
| Molecular Formula | C25H25ClFN3O2 |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-(4-fluoro-2-methoxyphenyl)pyridin-2-one;hydrochloride |
| SMILES | COc1cc(F)ccc1-c1ccn(-c2ccc3c4c(n(C)c3c2)CCN(C)C4)c(=O)c1.Cl |
| InChI | InChI=1S/C25H24FN3O2.ClH/c1-27-10-9-22-21(15-27)20-7-5-18(14-23(20)28(22)2)29-11-8-16(12-25(29)30)19-6-4-17(26)13-24(19)31-3;/h4-8,11-14H,9-10,15H2,1-3H3;1H |
| InChIKey | PXJKDCJINDODCT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 39.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|