C36H51N3O6Si3 — CID 68657802
1,3,5-tris[1-(methoxy-methyl-phenylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 68657802) has the molecular formula C36H51N3O6Si3 and a molecular weight of 706.08 g/mol. Its IUPAC name is 1,3,5-tris[1-(methoxy-methyl-phenylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[1-(methoxy-methyl-phenylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 68657802 |
| Molecular Formula | C36H51N3O6Si3 |
| Molecular Weight | 706.08 g/mol |
| Exact Mass | 705.31 |
| IUPAC Name | 1,3,5-tris[1-(methoxy-methyl-phenylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCC(n1c(=O)n(C(CC)[Si](C)(OC)c2ccccc2)c(=O)n(C(CC)[Si](C)(OC)c2ccccc2)c1=O)[Si](C)(OC)c1ccccc1 |
| InChI | InChI=1S/C36H51N3O6Si3/c1-10-31(46(7,43-4)28-22-16-13-17-23-28)37-34(40)38(32(11-2)47(8,44-5)29-24-18-14-19-25-29)36(42)39(35(37)41)33(12-3)48(9,45-6)30-26-20-15-21-27-30/h13-27,31-33H,10-12H2,1-9H3 |
| InChIKey | OWMSFDGZDMKWJM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.08 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|