C19H27BN2O3 — CID 68658124
N-cyclohexyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-amine (PubChem CID 68658124) has the molecular formula C19H27BN2O3 and a molecular weight of 342.25 g/mol. Its IUPAC name is N-cyclohexyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-amine.
| Compound Name | N-cyclohexyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 68658124 |
| Molecular Formula | C19H27BN2O3 |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-cyclohexyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-amine |
| SMILES | CC1(C)OB(c2ccc3oc(NC4CCCCC4)nc3c2)OC1(C)C |
| InChI | InChI=1S/C19H27BN2O3/c1-18(2)19(3,4)25-20(24-18)13-10-11-16-15(12-13)22-17(23-16)21-14-8-6-5-7-9-14/h10-12,14H,5-9H2,1-4H3,(H,21,22) |
| InChIKey | RBJMSCZJNCTEOT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|