C15H14N6 — CID 6865815
N-[(E)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 6865815) has the molecular formula C15H14N6 and a molecular weight of 278.32 g/mol. Its IUPAC name is N-[(E)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[(E)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 6865815 |
| Molecular Formula | C15H14N6 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[(E)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CC(/C=N/Nc1ccc2nncn2n1)=C\c1ccccc1 |
| InChI | InChI=1S/C15H14N6/c1-12(9-13-5-3-2-4-6-13)10-16-18-14-7-8-15-19-17-11-21(15)20-14/h2-11H,1H3,(H,18,20)/b12-9+,16-10+ |
| InChIKey | FHSHFEHQQNGWFW-JXTNESPGSA-N |
| XLogP | 2.63 |
| TPSA | 67.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|