C22H30O3 — CID 68658210
(10S,13S,17S)-17-(2-methoxyacetyl)-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 68658210) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (10S,13S,17S)-17-(2-methoxyacetyl)-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10S,13S,17S)-17-(2-methoxyacetyl)-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 68658210 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (10S,13S,17S)-17-(2-methoxyacetyl)-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | COCC(=O)[C@H]1CCC2C3CCC4=CC(=O)CC[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C22H30O3/c1-21-10-8-15(23)12-14(21)4-5-16-17-6-7-19(20(24)13-25-3)22(17,2)11-9-18(16)21/h9,12,16-17,19H,4-8,10-11,13H2,1-3H3/t16?,17?,19-,21+,22+/m1/s1 |
| InChIKey | DZGPRJJYNKCIKJ-RFUWLZLPSA-N |
| XLogP | 4.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|