About methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate
methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate (PubChem CID 68658424) has the molecular formula C13H13NO5
and a molecular weight of 263.25 g/mol. Its IUPAC name is methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate.
Molecular Properties
| Compound Name | methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate |
| PubChem CID | 68658424 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C1(OCCCO1)C(=O)N2 |
| InChI | InChI=1S/C13H13NO5/c1-17-11(15)8-3-4-10-9(7-8)13(12(16)14-10)18-5-2-6-19-13/h3-4,7H,2,5-6H2,1H3,(H,14,16) |
| InChIKey | JBXPABBHTHCQEQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate?
The IUPAC name of methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate (CID 68658424) is methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate.
What is the SMILES notation for methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate?
The canonical SMILES for methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate is COC(=O)c1ccc2c(c1)C1(OCCCO1)C(=O)N2.
What is the InChIKey of methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate?
The InChIKey is JBXPABBHTHCQEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5/c1-17-11(15)8-3-4-10-9(7-8)13(12(16)14-10)18-5-2-6-19-13/h3-4,7H,2,5-6H2,1H3,(H,14,16).
What are the key properties of methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate?
methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate has a molecular weight of 263.25 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2'-oxospiro[1,3-dioxane-2,3'-1H-indole]-5'-carboxylate is sourced from PubChem (CID 68658424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).