C27H45N5O10 — CID 68658426
2-[[(6S,12S,16E)-9,9-dimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-2-carbonyl]amino]propanoic acid (PubChem CID 68658426) has the molecular formula C27H45N5O10 and a molecular weight of 599.68 g/mol. Its IUPAC name is 2-[[(6S,12S,16E)-9,9-dimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-2-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[(6S,12S,16E)-9,9-dimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 68658426 |
| Molecular Formula | C27H45N5O10 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | 2-[[(6S,12S,16E)-9,9-dimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-2-carbonyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C1CNC(=O)[C@H](C(C)C)NC(=O)C(C)(C)NC(=O)[C@@H](NC(=O)OC(C)(C)C)COC/C=C/CO1)C(=O)O |
| InChI | InChI=1S/C27H45N5O10/c1-15(2)19-22(35)28-13-18(21(34)29-16(3)23(36)37)41-12-10-9-11-40-14-17(30-25(39)42-26(4,5)6)20(33)32-27(7,8)24(38)31-19/h9-10,15-19H,11-14H2,1-8H3,(H,28,35)(H,29,34)(H,30,39)(H,31,38)(H,32,33)(H,36,37)/b10-9+/t16?,17-,18?,19-/m0/s1 |
| InChIKey | GYVMIKUBIPGMAS-HXUORLLNSA-N |
| XLogP | -0.41 |
| TPSA | 210.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|