C13H26OSi3 — CID 68659565
2,4,6-tris(ethenyl)-2,3,3,4,6-pentamethyloxatrisilinane (PubChem CID 68659565) has the molecular formula C13H26OSi3 and a molecular weight of 282.61 g/mol. Its IUPAC name is 2,4,6-tris(ethenyl)-2,3,3,4,6-pentamethyloxatrisilinane.
| Compound Name | 2,4,6-tris(ethenyl)-2,3,3,4,6-pentamethyloxatrisilinane |
|---|---|
| PubChem CID | 68659565 |
| Molecular Formula | C13H26OSi3 |
| Molecular Weight | 282.61 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2,4,6-tris(ethenyl)-2,3,3,4,6-pentamethyloxatrisilinane |
| SMILES | C=CC1(C)C[Si](C)(C=C)[Si](C)(C)[Si](C)(C=C)O1 |
| InChI | InChI=1S/C13H26OSi3/c1-9-13(4)12-16(7,10-2)15(5,6)17(8,11-3)14-13/h9-11H,1-3,12H2,4-8H3 |
| InChIKey | DNMSTUBGJUDUGA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|