About CID 68659588
CID 68659588 (PubChem CID 68659588) has the molecular formula C20H27O2Si
and a molecular weight of 327.52 g/mol.
Molecular Properties
| Compound Name | CID 68659588 |
| PubChem CID | 68659588 |
| Molecular Formula | C20H27O2Si |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | — |
| SMILES | CCCO[Si](OCCC)c1c(C)cc(-c2ccccc2)cc1C |
| InChI | InChI=1S/C20H27O2Si/c1-5-12-21-23(22-13-6-2)20-16(3)14-19(15-17(20)4)18-10-8-7-9-11-18/h7-11,14-15H,5-6,12-13H2,1-4H3 |
| InChIKey | QPOAYJUUTCVKPD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68659588 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68659588?
The IUPAC name of CID 68659588 (CID 68659588) is not available.
What is the SMILES notation for CID 68659588?
The canonical SMILES for CID 68659588 is CCCO[Si](OCCC)c1c(C)cc(-c2ccccc2)cc1C.
What is the InChIKey of CID 68659588?
The InChIKey is QPOAYJUUTCVKPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27O2Si/c1-5-12-21-23(22-13-6-2)20-16(3)14-19(15-17(20)4)18-10-8-7-9-11-18/h7-11,14-15H,5-6,12-13H2,1-4H3.
What are the key properties of CID 68659588?
CID 68659588 has a molecular weight of 327.52 g/mol, XLogP of 4.52, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68659588 is sourced from PubChem (CID 68659588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).