About CID 68659972
CID 68659972 (PubChem CID 68659972) has the molecular formula C13H12OSi2
and a molecular weight of 240.41 g/mol.
Molecular Properties
| Compound Name | CID 68659972 |
| PubChem CID | 68659972 |
| Molecular Formula | C13H12OSi2 |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2ccccc2[Si](O)[Si])cc1 |
| InChI | InChI=1S/C13H12OSi2/c1-10-6-8-11(9-7-10)12-4-2-3-5-13(12)16(14)15/h2-9,14H,1H3 |
| InChIKey | SIOGYMDAIGSYQL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68659972 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68659972?
The IUPAC name of CID 68659972 (CID 68659972) is not available.
What is the SMILES notation for CID 68659972?
The canonical SMILES for CID 68659972 is Cc1ccc(-c2ccccc2[Si](O)[Si])cc1.
What is the InChIKey of CID 68659972?
The InChIKey is SIOGYMDAIGSYQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12OSi2/c1-10-6-8-11(9-7-10)12-4-2-3-5-13(12)16(14)15/h2-9,14H,1H3.
What are the key properties of CID 68659972?
CID 68659972 has a molecular weight of 240.41 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68659972 is sourced from PubChem (CID 68659972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).