C12H19NO3 — CID 68660046
1-(8-hydroxyoctyl)pyrrole-2,5-dione (PubChem CID 68660046) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-(8-hydroxyoctyl)pyrrole-2,5-dione.
| Compound Name | 1-(8-hydroxyoctyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 68660046 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 1-(8-hydroxyoctyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCCCCCCO |
| InChI | InChI=1S/C12H19NO3/c14-10-6-4-2-1-3-5-9-13-11(15)7-8-12(13)16/h7-8,14H,1-6,9-10H2 |
| InChIKey | CMQWWSVCTWVKFM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|