C15H14N6S — CID 6866073
3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-[(E)-3-phenylprop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione (PubChem CID 6866073) has the molecular formula C15H14N6S and a molecular weight of 310.39 g/mol. Its IUPAC name is 3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-[(E)-3-phenylprop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-[(E)-3-phenylprop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6866073 |
| Molecular Formula | C15H14N6S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-[(E)-3-phenylprop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(-c2n[nH]c(=S)n2/N=C/C=C/c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C15H14N6S/c1-11-10-13(18-17-11)14-19-20-15(22)21(14)16-9-5-8-12-6-3-2-4-7-12/h2-10H,1H3,(H,17,18)(H,20,22)/b8-5+,16-9+ |
| InChIKey | SAGUFNOYZLINCE-ZCPHBQKFSA-N |
| XLogP | 3.19 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|