About 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide
2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide (PubChem CID 68660827) has the molecular formula C17H20FN3O2
and a molecular weight of 317.36 g/mol. Its IUPAC name is 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide.
Molecular Properties
| Compound Name | 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide |
| PubChem CID | 68660827 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide |
| SMILES | CN(C)C(=O)C(C)(C)Nc1ncc(-c2cccc(F)c2)cc1O |
| InChI | InChI=1S/C17H20FN3O2/c1-17(2,16(23)21(3)4)20-15-14(22)9-12(10-19-15)11-6-5-7-13(18)8-11/h5-10,22H,1-4H3,(H,19,20) |
| InChIKey | GRKUCTMXCOXBSZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide?
The IUPAC name of 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide (CID 68660827) is 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide.
What is the SMILES notation for 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide?
The canonical SMILES for 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide is CN(C)C(=O)C(C)(C)Nc1ncc(-c2cccc(F)c2)cc1O.
What is the InChIKey of 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide?
The InChIKey is GRKUCTMXCOXBSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN3O2/c1-17(2,16(23)21(3)4)20-15-14(22)9-12(10-19-15)11-6-5-7-13(18)8-11/h5-10,22H,1-4H3,(H,19,20).
What are the key properties of 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide?
2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide has a molecular weight of 317.36 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]amino]-N,N,2-trimethylpropanamide is sourced from PubChem (CID 68660827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).