About (4-methylcyclohexyl)methyl 2-methylpropyl carbonate
(4-methylcyclohexyl)methyl 2-methylpropyl carbonate (PubChem CID 68661013) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is (4-methylcyclohexyl)methyl 2-methylpropyl carbonate.
Molecular Properties
| Compound Name | (4-methylcyclohexyl)methyl 2-methylpropyl carbonate |
| PubChem CID | 68661013 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (4-methylcyclohexyl)methyl 2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)OCC1CCC(C)CC1 |
| InChI | InChI=1S/C13H24O3/c1-10(2)8-15-13(14)16-9-12-6-4-11(3)5-7-12/h10-12H,4-9H2,1-3H3 |
| InChIKey | LXIMMPLNKZTSBJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methylcyclohexyl)methyl 2-methylpropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylcyclohexyl)methyl 2-methylpropyl carbonate?
The IUPAC name of (4-methylcyclohexyl)methyl 2-methylpropyl carbonate (CID 68661013) is (4-methylcyclohexyl)methyl 2-methylpropyl carbonate.
What is the SMILES notation for (4-methylcyclohexyl)methyl 2-methylpropyl carbonate?
The canonical SMILES for (4-methylcyclohexyl)methyl 2-methylpropyl carbonate is CC(C)COC(=O)OCC1CCC(C)CC1.
What is the InChIKey of (4-methylcyclohexyl)methyl 2-methylpropyl carbonate?
The InChIKey is LXIMMPLNKZTSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-10(2)8-15-13(14)16-9-12-6-4-11(3)5-7-12/h10-12H,4-9H2,1-3H3.
What are the key properties of (4-methylcyclohexyl)methyl 2-methylpropyl carbonate?
(4-methylcyclohexyl)methyl 2-methylpropyl carbonate has a molecular weight of 228.33 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylcyclohexyl)methyl 2-methylpropyl carbonate is sourced from PubChem (CID 68661013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).