About 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol
4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol (PubChem CID 68661255) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol |
| PubChem CID | 68661255 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol |
| SMILES | CC=CC1(OC)C=C(OC)C(O)=CC1 |
| InChI | InChI=1S/C11H16O3/c1-4-6-11(14-3)7-5-9(12)10(8-11)13-2/h4-6,8,12H,7H2,1-3H3 |
| InChIKey | YLYBZKUKXNKIRJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol?
The IUPAC name of 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol (CID 68661255) is 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol?
The canonical SMILES for 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol is CC=CC1(OC)C=C(OC)C(O)=CC1.
What is the InChIKey of 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol?
The InChIKey is YLYBZKUKXNKIRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-4-6-11(14-3)7-5-9(12)10(8-11)13-2/h4-6,8,12H,7H2,1-3H3.
What are the key properties of 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol?
4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol has a molecular weight of 196.25 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxy-4-prop-1-enylcyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 68661255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).