About 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid
3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid (PubChem CID 68662059) has the molecular formula C22H16F2N2O4
and a molecular weight of 410.38 g/mol. Its IUPAC name is 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid.
Molecular Properties
| Compound Name | 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid |
| PubChem CID | 68662059 |
| Molecular Formula | C22H16F2N2O4 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid |
| SMILES | Cn1c(COc2cccc(C(=O)O)c2)nc2ccc(Oc3ccc(F)cc3F)cc21 |
| InChI | InChI=1S/C22H16F2N2O4/c1-26-19-11-16(30-20-8-5-14(23)10-17(20)24)6-7-18(19)25-21(26)12-29-15-4-2-3-13(9-15)22(27)28/h2-11H,12H2,1H3,(H,27,28) |
| InChIKey | JSADKAUCLOIJDV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid?
The IUPAC name of 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid (CID 68662059) is 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid.
What is the SMILES notation for 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid?
The canonical SMILES for 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid is Cn1c(COc2cccc(C(=O)O)c2)nc2ccc(Oc3ccc(F)cc3F)cc21.
What is the InChIKey of 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid?
The InChIKey is JSADKAUCLOIJDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F2N2O4/c1-26-19-11-16(30-20-8-5-14(23)10-17(20)24)6-7-18(19)25-21(26)12-29-15-4-2-3-13(9-15)22(27)28/h2-11H,12H2,1H3,(H,27,28).
What are the key properties of 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid?
3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid has a molecular weight of 410.38 g/mol, XLogP of 4.92, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[6-(2,4-difluorophenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoic acid is sourced from PubChem (CID 68662059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).