About 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide
2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide (PubChem CID 68662569) has the molecular formula C22H14INO6
and a molecular weight of 515.26 g/mol. Its IUPAC name is 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide.
Molecular Properties
| Compound Name | 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide |
| PubChem CID | 68662569 |
| Molecular Formula | C22H14INO6 |
| Molecular Weight | 515.26 g/mol |
| Exact Mass | 514.99 |
| IUPAC Name | 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide |
| SMILES | NC(=O)C(I)c1ccc2c(c1)C1(OC2=O)c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H14INO6/c23-19(20(24)27)10-1-4-13-16(7-10)22(30-21(13)28)14-5-2-11(25)8-17(14)29-18-9-12(26)3-6-15(18)22/h1-9,19,25-26H,(H2,24,27) |
| InChIKey | CXDVRDLFVWTORB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide?
The IUPAC name of 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide (CID 68662569) is 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide.
What is the SMILES notation for 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide?
The canonical SMILES for 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide is NC(=O)C(I)c1ccc2c(c1)C1(OC2=O)c2ccc(O)cc2Oc2cc(O)ccc21.
What is the InChIKey of 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide?
The InChIKey is CXDVRDLFVWTORB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14INO6/c23-19(20(24)27)10-1-4-13-16(7-10)22(30-21(13)28)14-5-2-11(25)8-17(14)29-18-9-12(26)3-6-15(18)22/h1-9,19,25-26H,(H2,24,27).
What are the key properties of 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide?
2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide has a molecular weight of 515.26 g/mol, XLogP of 3.63, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-yl)-2-iodoacetamide is sourced from PubChem (CID 68662569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).