About methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate
methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate (PubChem CID 68662676) has the molecular formula C32H26N2O2
and a molecular weight of 470.57 g/mol. Its IUPAC name is methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate |
| PubChem CID | 68662676 |
| Molecular Formula | C32H26N2O2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)c(C)c(-c2ccccc2)n(-c2ccccc2)/c1=N/c1ccccc1 |
| InChI | InChI=1S/C32H26N2O2/c1-23-28(24-15-7-3-8-16-24)29(32(35)36-2)31(33-26-19-11-5-12-20-26)34(27-21-13-6-14-22-27)30(23)25-17-9-4-10-18-25/h3-22H,1-2H3/b33-31+ |
| InChIKey | LYZNYAPVRWELED-QOSDPKFLSA-N |
| XLogP | 7.14 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate?
The IUPAC name of methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate (CID 68662676) is methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate.
What is the SMILES notation for methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate?
The canonical SMILES for methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate is COC(=O)c1c(-c2ccccc2)c(C)c(-c2ccccc2)n(-c2ccccc2)/c1=N/c1ccccc1.
What is the InChIKey of methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate?
The InChIKey is LYZNYAPVRWELED-QOSDPKFLSA-N. The full InChI is InChI=1S/C32H26N2O2/c1-23-28(24-15-7-3-8-16-24)29(32(35)36-2)31(33-26-19-11-5-12-20-26)34(27-21-13-6-14-22-27)30(23)25-17-9-4-10-18-25/h3-22H,1-2H3/b33-31+.
What are the key properties of methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate?
methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate has a molecular weight of 470.57 g/mol, XLogP of 7.14, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-1,4,6-triphenyl-2-phenyliminopyridine-3-carboxylate is sourced from PubChem (CID 68662676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).