C10H10Cl2N2O3S — CID 68662736
6,8-dichloro-1,1-dioxo-2-propyl-4H-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 68662736) has the molecular formula C10H10Cl2N2O3S and a molecular weight of 309.17 g/mol. Its IUPAC name is 6,8-dichloro-1,1-dioxo-2-propyl-4H-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 6,8-dichloro-1,1-dioxo-2-propyl-4H-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 68662736 |
| Molecular Formula | C10H10Cl2N2O3S |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 6,8-dichloro-1,1-dioxo-2-propyl-4H-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | CCCN1C(=O)Nc2cc(Cl)cc(Cl)c2S1(=O)=O |
| InChI | InChI=1S/C10H10Cl2N2O3S/c1-2-3-14-10(15)13-8-5-6(11)4-7(12)9(8)18(14,16)17/h4-5H,2-3H2,1H3,(H,13,15) |
| InChIKey | XCRYFYAOPOYNAR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |