C12H15NO3 — CID 68662953
(1S,2R,6S,7S,8R)-8-hydroxy-8-prop-2-enyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 68662953) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (1S,2R,6S,7S,8R)-8-hydroxy-8-prop-2-enyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7S,8R)-8-hydroxy-8-prop-2-enyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 68662953 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (1S,2R,6S,7S,8R)-8-hydroxy-8-prop-2-enyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C=CC[C@@]1(O)C[C@@H]2C[C@H]1[C@@H]1C(=O)NC(=O)[C@H]21 |
| InChI | InChI=1S/C12H15NO3/c1-2-3-12(16)5-6-4-7(12)9-8(6)10(14)13-11(9)15/h2,6-9,16H,1,3-5H2,(H,13,14,15)/t6-,7-,8+,9-,12+/m0/s1 |
| InChIKey | PRZYHNXYIHXLLR-QDUYUBIDSA-N |
| XLogP | 0.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|