About 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride
4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride (PubChem CID 68663344) has the molecular formula C14H15ClN2O2
and a molecular weight of 278.74 g/mol. Its IUPAC name is 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride.
Molecular Properties
| Compound Name | 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride |
| PubChem CID | 68663344 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cccc2c1C(=O)CC1(CCNCC1)O2 |
| InChI | InChI=1S/C14H14N2O2.ClH/c15-9-10-2-1-3-12-13(10)11(17)8-14(18-12)4-6-16-7-5-14;/h1-3,16H,4-8H2;1H |
| InChIKey | OZCOYMSGZUGWKR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride?
The IUPAC name of 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride (CID 68663344) is 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride.
What is the SMILES notation for 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride?
The canonical SMILES for 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride is Cl.N#Cc1cccc2c1C(=O)CC1(CCNCC1)O2.
What is the InChIKey of 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride?
The InChIKey is OZCOYMSGZUGWKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2.ClH/c15-9-10-2-1-3-12-13(10)11(17)8-14(18-12)4-6-16-7-5-14;/h1-3,16H,4-8H2;1H.
What are the key properties of 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride?
4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride has a molecular weight of 278.74 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxospiro[3H-chromene-2,4'-piperidine]-5-carbonitrile;hydrochloride is sourced from PubChem (CID 68663344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).